C16H28NSi+ — CID 10249736
[(1S,2R)-1-ethyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]methyl-trimethylsilane (PubChem CID 10249736) has the molecular formula C16H28NSi+ and a molecular weight of 262.49 g/mol. Its IUPAC name is [(1S,2R)-1-ethyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]methyl-trimethylsilane.
| Compound Name | [(1S,2R)-1-ethyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 10249736 |
| Molecular Formula | C16H28NSi+ |
| Molecular Weight | 262.49 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | [(1S,2R)-1-ethyl-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]methyl-trimethylsilane |
| SMILES | CC[C@H]1c2ccccc2CC[N@@+]1(C)C[Si](C)(C)C |
| InChI | InChI=1S/C16H28NSi/c1-6-16-15-10-8-7-9-14(15)11-12-17(16,2)13-18(3,4)5/h7-10,16H,6,11-13H2,1-5H3/q+1/t16-,17-/m0/s1 |
| InChIKey | DDFWGTAQGKBBAT-IRXDYDNUSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|