C27H38N2O2+2 — CID 129295163
2-(2-methoxyethyl)-1-[2-[2-(2-methoxyethyl)-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-1-yl]ethyl]-3,4-dihydroisoquinolin-2-ium (PubChem CID 129295163) has the molecular formula C27H38N2O2+2 and a molecular weight of 422.61 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-1-[2-[2-(2-methoxyethyl)-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-1-yl]ethyl]-3,4-dihydroisoquinolin-2-ium.
| Compound Name | 2-(2-methoxyethyl)-1-[2-[2-(2-methoxyethyl)-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-1-yl]ethyl]-3,4-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 129295163 |
| Molecular Formula | C27H38N2O2+2 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | 2-(2-methoxyethyl)-1-[2-[2-(2-methoxyethyl)-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-1-yl]ethyl]-3,4-dihydroisoquinolin-2-ium |
| SMILES | COCC[N+]1=C(CCC2c3ccccc3CC[N+]2(C)CCOC)c2ccccc2CC1 |
| InChI | InChI=1S/C27H38N2O2/c1-29(19-21-31-3)18-15-23-9-5-7-11-25(23)27(29)13-12-26-24-10-6-4-8-22(24)14-16-28(26)17-20-30-2/h4-11,27H,12-21H2,1-3H3/q+2 |
| InChIKey | OUXOGGKEVREQLU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|