C31H46N2O4+2 — CID 129295160
2-(2-methoxyethyl)-1-[2-[2-[2-[2-(2-methoxyethyl)-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-1-yl]ethoxy]ethoxy]ethyl]-3,4-dihydroisoquinolin-2-ium (PubChem CID 129295160) has the molecular formula C31H46N2O4+2 and a molecular weight of 510.72 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-1-[2-[2-[2-[2-(2-methoxyethyl)-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-1-yl]ethoxy]ethoxy]ethyl]-3,4-dihydroisoquinolin-2-ium.
| Compound Name | 2-(2-methoxyethyl)-1-[2-[2-[2-[2-(2-methoxyethyl)-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-1-yl]ethoxy]ethoxy]ethyl]-3,4-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 129295160 |
| Molecular Formula | C31H46N2O4+2 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.34 |
| IUPAC Name | 2-(2-methoxyethyl)-1-[2-[2-[2-[2-(2-methoxyethyl)-2-methyl-3,4-dihydro-1H-isoquinolin-2-ium-1-yl]ethoxy]ethoxy]ethyl]-3,4-dihydroisoquinolin-2-ium |
| SMILES | COCC[N+]1=C(CCOCCOCCC2c3ccccc3CC[N+]2(C)CCOC)c2ccccc2CC1 |
| InChI | InChI=1S/C31H46N2O4/c1-33(19-23-35-3)18-13-27-9-5-7-11-29(27)31(33)15-21-37-25-24-36-20-14-30-28-10-6-4-8-26(28)12-16-32(30)17-22-34-2/h4-11,31H,12-25H2,1-3H3/q+2 |
| InChIKey | IOMGLNUYKPIVPF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|