C24H30N2+2 — CID 129295182
2-methyl-1-[4-(2-methyl-3,4-dihydroisoquinolin-2-ium-1-yl)butyl]-3,4-dihydroisoquinolin-2-ium (PubChem CID 129295182) has the molecular formula C24H30N2+2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 2-methyl-1-[4-(2-methyl-3,4-dihydroisoquinolin-2-ium-1-yl)butyl]-3,4-dihydroisoquinolin-2-ium.
| Compound Name | 2-methyl-1-[4-(2-methyl-3,4-dihydroisoquinolin-2-ium-1-yl)butyl]-3,4-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 129295182 |
| Molecular Formula | C24H30N2+2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 2-methyl-1-[4-(2-methyl-3,4-dihydroisoquinolin-2-ium-1-yl)butyl]-3,4-dihydroisoquinolin-2-ium |
| SMILES | C[N+]1=C(CCCCC2=[N+](C)CCc3ccccc32)c2ccccc2CC1 |
| InChI | InChI=1S/C24H30N2/c1-25-17-15-19-9-3-5-11-21(19)23(25)13-7-8-14-24-22-12-6-4-10-20(22)16-18-26(24)2/h3-6,9-12H,7-8,13-18H2,1-2H3/q+2 |
| InChIKey | CFYZZBVTDDAVCS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|