C22H28INO4 — CID 11995052
1-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium iodide (PubChem CID 11995052) has the molecular formula C22H28INO4 and a molecular weight of 497.37 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium iodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium iodide |
|---|---|
| PubChem CID | 11995052 |
| Molecular Formula | C22H28INO4 |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium iodide |
| SMILES | COc1ccc(CCC2=[N+](C)CCc3cc(OC)c(OC)cc32)cc1OC.[I-] |
| InChI | InChI=1S/C22H28NO4.HI/c1-23-11-10-16-13-21(26-4)22(27-5)14-17(16)18(23)8-6-15-7-9-19(24-2)20(12-15)25-3;/h7,9,12-14H,6,8,10-11H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | FZUMTZKIPZYTQF-UHFFFAOYSA-M |
| XLogP | 0.35 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|