C32H34O8 — CID 172870659
2-[2-(3,4-dimethoxyphenyl)ethyl]-5-[4-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dihydroxyphenyl]benzene-1,4-diol (PubChem CID 172870659) has the molecular formula C32H34O8 and a molecular weight of 546.62 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethyl]-5-[4-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dihydroxyphenyl]benzene-1,4-diol.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-5-[4-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dihydroxyphenyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 172870659 |
| Molecular Formula | C32H34O8 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-5-[4-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dihydroxyphenyl]benzene-1,4-diol |
| SMILES | COc1ccc(CCc2cc(O)c(-c3cc(O)c(CCc4ccc(OC)c(OC)c4)cc3O)cc2O)cc1OC |
| InChI | InChI=1S/C32H34O8/c1-37-29-11-7-19(13-31(29)39-3)5-9-21-15-27(35)23(17-25(21)33)24-18-26(34)22(16-28(24)36)10-6-20-8-12-30(38-2)32(14-20)40-4/h7-8,11-18,33-36H,5-6,9-10H2,1-4H3 |
| InChIKey | DLRMLEFONRDXMO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|