C16H19NO3 — CID 1204262
2-[2-(3,4-dimethoxyphenyl)ethyl]-6-methylpyridin-3-ol (PubChem CID 1204262) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethyl]-6-methylpyridin-3-ol.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-6-methylpyridin-3-ol |
|---|---|
| PubChem CID | 1204262 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethyl]-6-methylpyridin-3-ol |
| SMILES | COc1ccc(CCc2nc(C)ccc2O)cc1OC |
| InChI | InChI=1S/C16H19NO3/c1-11-4-8-14(18)13(17-11)7-5-12-6-9-15(19-2)16(10-12)20-3/h4,6,8-10,18H,5,7H2,1-3H3 |
| InChIKey | CDNMMYKXMVEHCZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |