C16H24INO2 — CID 11995568
6,7-dimethoxy-2-methyl-1-(2-methylpropyl)-3,4-dihydroisoquinolin-2-ium iodide (PubChem CID 11995568) has the molecular formula C16H24INO2 and a molecular weight of 389.28 g/mol. Its IUPAC name is 6,7-dimethoxy-2-methyl-1-(2-methylpropyl)-3,4-dihydroisoquinolin-2-ium iodide.
| Compound Name | 6,7-dimethoxy-2-methyl-1-(2-methylpropyl)-3,4-dihydroisoquinolin-2-ium iodide |
|---|---|
| PubChem CID | 11995568 |
| Molecular Formula | C16H24INO2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 6,7-dimethoxy-2-methyl-1-(2-methylpropyl)-3,4-dihydroisoquinolin-2-ium iodide |
| SMILES | COc1cc2c(cc1OC)C(CC(C)C)=[N+](C)CC2.[I-] |
| InChI | InChI=1S/C16H24NO2.HI/c1-11(2)8-14-13-10-16(19-5)15(18-4)9-12(13)6-7-17(14)3;/h9-11H,6-8H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | DGIBEENHVSOJEV-UHFFFAOYSA-M |
| XLogP | -0.26 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|