C21H25FNO2+ — CID 87620515
2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-1-propan-2-yl-3,4-dihydroisoquinolin-2-ium (PubChem CID 87620515) has the molecular formula C21H25FNO2+ and a molecular weight of 342.43 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-1-propan-2-yl-3,4-dihydroisoquinolin-2-ium.
| Compound Name | 2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-1-propan-2-yl-3,4-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 87620515 |
| Molecular Formula | C21H25FNO2+ |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-[(2-fluorophenyl)methyl]-6,7-dimethoxy-1-propan-2-yl-3,4-dihydroisoquinolin-2-ium |
| SMILES | COc1cc2c(cc1OC)C(C(C)C)=[N+](Cc1ccccc1F)CC2 |
| InChI | InChI=1S/C21H25FNO2/c1-14(2)21-17-12-20(25-4)19(24-3)11-15(17)9-10-23(21)13-16-7-5-6-8-18(16)22/h5-8,11-12,14H,9-10,13H2,1-4H3/q+1 |
| InChIKey | HJOKCCUBVOPZEW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|