C25H33ClN2O4 — CID 87620522
1-heptyl-6,7-dimethoxy-2-[(2-nitrophenyl)methyl]-3,4-dihydroisoquinolin-2-ium chloride (PubChem CID 87620522) has the molecular formula C25H33ClN2O4 and a molecular weight of 461.00 g/mol. Its IUPAC name is 1-heptyl-6,7-dimethoxy-2-[(2-nitrophenyl)methyl]-3,4-dihydroisoquinolin-2-ium chloride.
| Compound Name | 1-heptyl-6,7-dimethoxy-2-[(2-nitrophenyl)methyl]-3,4-dihydroisoquinolin-2-ium chloride |
|---|---|
| PubChem CID | 87620522 |
| Molecular Formula | C25H33ClN2O4 |
| Molecular Weight | 461.00 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 1-heptyl-6,7-dimethoxy-2-[(2-nitrophenyl)methyl]-3,4-dihydroisoquinolin-2-ium chloride |
| SMILES | CCCCCCCC1=[N+](Cc2ccccc2[N+](=O)[O-])CCc2cc(OC)c(OC)cc21.[Cl-] |
| InChI | InChI=1S/C25H33N2O4.ClH/c1-4-5-6-7-8-13-23-21-17-25(31-3)24(30-2)16-19(21)14-15-26(23)18-20-11-9-10-12-22(20)27(28)29;/h9-12,16-17H,4-8,13-15,18H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | RUTUTNONTPCAIT-UHFFFAOYSA-M |
| XLogP | 2.53 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.00 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|