C21H24Cl2FNO2 — CID 157088109
2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-propyl-3,4-dihydroisoquinolin-2-ium chloride (PubChem CID 157088109) has the molecular formula C21H24Cl2FNO2 and a molecular weight of 412.33 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-propyl-3,4-dihydroisoquinolin-2-ium chloride.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-propyl-3,4-dihydroisoquinolin-2-ium chloride |
|---|---|
| PubChem CID | 157088109 |
| Molecular Formula | C21H24Cl2FNO2 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-propyl-3,4-dihydroisoquinolin-2-ium chloride |
| SMILES | CCCC1=[N+](Cc2c(F)cccc2Cl)CCc2cc(OC)c(OC)cc21.[Cl-] |
| InChI | InChI=1S/C21H24ClFNO2.ClH/c1-4-6-19-15-12-21(26-3)20(25-2)11-14(15)9-10-24(19)13-16-17(22)7-5-8-18(16)23;/h5,7-8,11-12H,4,6,9-10,13H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | AEIFUXZVIPGGAT-UHFFFAOYSA-M |
| XLogP | 1.86 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|