C25H33ClNO2+ — CID 87621434
2-[(2-chlorophenyl)methyl]-1-heptyl-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium (PubChem CID 87621434) has the molecular formula C25H33ClNO2+ and a molecular weight of 415.00 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-1-heptyl-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium.
| Compound Name | 2-[(2-chlorophenyl)methyl]-1-heptyl-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 87621434 |
| Molecular Formula | C25H33ClNO2+ |
| Molecular Weight | 415.00 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-1-heptyl-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium |
| SMILES | CCCCCCCC1=[N+](Cc2ccccc2Cl)CCc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C25H33ClNO2/c1-4-5-6-7-8-13-23-21-17-25(29-3)24(28-2)16-19(21)14-15-27(23)18-20-11-9-10-12-22(20)26/h9-12,16-17H,4-8,13-15,18H2,1-3H3/q+1 |
| InChIKey | ONQUIAJZDFVMOZ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.00 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|