C25H32F2NO2+ — CID 87622147
2-[(3,4-difluorophenyl)methyl]-1-heptyl-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium (PubChem CID 87622147) has the molecular formula C25H32F2NO2+ and a molecular weight of 416.53 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)methyl]-1-heptyl-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium.
| Compound Name | 2-[(3,4-difluorophenyl)methyl]-1-heptyl-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 87622147 |
| Molecular Formula | C25H32F2NO2+ |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 2-[(3,4-difluorophenyl)methyl]-1-heptyl-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium |
| SMILES | CCCCCCCC1=[N+](Cc2ccc(F)c(F)c2)CCc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C25H32F2NO2/c1-4-5-6-7-8-9-23-20-16-25(30-3)24(29-2)15-19(20)12-13-28(23)17-18-10-11-21(26)22(27)14-18/h10-11,14-16H,4-9,12-13,17H2,1-3H3/q+1 |
| InChIKey | JTOGVGVQNBJWAG-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|