C25H33N2O5+ — CID 86633837
4-[(1-heptyl-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium-2-yl)methyl]-2-nitrophenol (PubChem CID 86633837) has the molecular formula C25H33N2O5+ and a molecular weight of 441.55 g/mol. Its IUPAC name is 4-[(1-heptyl-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium-2-yl)methyl]-2-nitrophenol.
| Compound Name | 4-[(1-heptyl-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium-2-yl)methyl]-2-nitrophenol |
|---|---|
| PubChem CID | 86633837 |
| Molecular Formula | C25H33N2O5+ |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 4-[(1-heptyl-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium-2-yl)methyl]-2-nitrophenol |
| SMILES | CCCCCCCC1=[N+](Cc2ccc(O)c([N+](=O)[O-])c2)CCc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C25H32N2O5/c1-4-5-6-7-8-9-21-20-16-25(32-3)24(31-2)15-19(20)12-13-26(21)17-18-10-11-23(28)22(14-18)27(29)30/h10-11,14-16H,4-9,12-13,17H2,1-3H3/p+1 |
| InChIKey | KSAOQBYAGMNGKA-UHFFFAOYSA-O |
| XLogP | 5.24 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|