C27H29N2O4+ — CID 101114236
2-benzyl-6,7-diethoxy-1-[(2-nitrophenyl)methyl]-3,4-dihydroisoquinolin-2-ium (PubChem CID 101114236) has the molecular formula C27H29N2O4+ and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-benzyl-6,7-diethoxy-1-[(2-nitrophenyl)methyl]-3,4-dihydroisoquinolin-2-ium.
| Compound Name | 2-benzyl-6,7-diethoxy-1-[(2-nitrophenyl)methyl]-3,4-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 101114236 |
| Molecular Formula | C27H29N2O4+ |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 2-benzyl-6,7-diethoxy-1-[(2-nitrophenyl)methyl]-3,4-dihydroisoquinolin-2-ium |
| SMILES | CCOc1cc2c(cc1OCC)C(Cc1ccccc1[N+](=O)[O-])=[N+](Cc1ccccc1)CC2 |
| InChI | InChI=1S/C27H29N2O4/c1-3-32-26-17-21-14-15-28(19-20-10-6-5-7-11-20)25(23(21)18-27(26)33-4-2)16-22-12-8-9-13-24(22)29(30)31/h5-13,17-18H,3-4,14-16,19H2,1-2H3/q+1 |
| InChIKey | MPTUPRJJZJEQMQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|