C14H13NO3 — CID 175518367
bicyclo[2.2.0]hexa-1,3,5-triene;1-ethoxy-2-nitrobenzene (PubChem CID 175518367) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;1-ethoxy-2-nitrobenzene.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;1-ethoxy-2-nitrobenzene |
|---|---|
| PubChem CID | 175518367 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;1-ethoxy-2-nitrobenzene |
| SMILES | CCOc1ccccc1[N+](=O)[O-].c1cc2ccc1-2 |
| InChI | InChI=1S/C8H9NO3.C6H4/c1-2-12-8-6-4-3-5-7(8)9(10)11;1-2-6-4-3-5(1)6/h3-6H,2H2,1H3;1-4H |
| InChIKey | JXZMUGHSUYEQHW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|