About ethoxy (2-nitrophenyl) carbonate
ethoxy (2-nitrophenyl) carbonate (PubChem CID 88781671) has the molecular formula C9H9NO6
and a molecular weight of 227.17 g/mol. Its IUPAC name is ethoxy (2-nitrophenyl) carbonate.
Molecular Properties
| Compound Name | ethoxy (2-nitrophenyl) carbonate |
| PubChem CID | 88781671 |
| Molecular Formula | C9H9NO6 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | ethoxy (2-nitrophenyl) carbonate |
| SMILES | CCOOC(=O)Oc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9NO6/c1-2-14-16-9(11)15-8-6-4-3-5-7(8)10(12)13/h3-6H,2H2,1H3 |
| InChIKey | SQPMATPFBKVDRK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze ethoxy (2-nitrophenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxy (2-nitrophenyl) carbonate?
The IUPAC name of ethoxy (2-nitrophenyl) carbonate (CID 88781671) is ethoxy (2-nitrophenyl) carbonate.
What is the SMILES notation for ethoxy (2-nitrophenyl) carbonate?
The canonical SMILES for ethoxy (2-nitrophenyl) carbonate is CCOOC(=O)Oc1ccccc1[N+](=O)[O-].
What is the InChIKey of ethoxy (2-nitrophenyl) carbonate?
The InChIKey is SQPMATPFBKVDRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO6/c1-2-14-16-9(11)15-8-6-4-3-5-7(8)10(12)13/h3-6H,2H2,1H3.
What are the key properties of ethoxy (2-nitrophenyl) carbonate?
ethoxy (2-nitrophenyl) carbonate has a molecular weight of 227.17 g/mol, XLogP of 2.06, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy (2-nitrophenyl) carbonate is sourced from PubChem (CID 88781671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).