C13H16BrNO6 — CID 70518644
(2-nitrophenyl) 3-bromo-2,2-diethoxypropanoate (PubChem CID 70518644) has the molecular formula C13H16BrNO6 and a molecular weight of 362.18 g/mol. Its IUPAC name is (2-nitrophenyl) 3-bromo-2,2-diethoxypropanoate.
| Compound Name | (2-nitrophenyl) 3-bromo-2,2-diethoxypropanoate |
|---|---|
| PubChem CID | 70518644 |
| Molecular Formula | C13H16BrNO6 |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | (2-nitrophenyl) 3-bromo-2,2-diethoxypropanoate |
| SMILES | CCOC(CBr)(OCC)C(=O)Oc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16BrNO6/c1-3-19-13(9-14,20-4-2)12(16)21-11-8-6-5-7-10(11)15(17)18/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | LUXIGWWYDFAQJU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|