About (2-nitrophenyl) N-propan-2-ylcarbamate
(2-nitrophenyl) N-propan-2-ylcarbamate (PubChem CID 11241573) has the molecular formula C10H12N2O4
and a molecular weight of 224.22 g/mol. Its IUPAC name is (2-nitrophenyl) N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | (2-nitrophenyl) N-propan-2-ylcarbamate |
| PubChem CID | 11241573 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | (2-nitrophenyl) N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)Oc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12N2O4/c1-7(2)11-10(13)16-9-6-4-3-5-8(9)12(14)15/h3-7H,1-2H3,(H,11,13) |
| InChIKey | CTDRMIBQRKTHQG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrophenyl) N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrophenyl) N-propan-2-ylcarbamate?
The IUPAC name of (2-nitrophenyl) N-propan-2-ylcarbamate (CID 11241573) is (2-nitrophenyl) N-propan-2-ylcarbamate.
What is the SMILES notation for (2-nitrophenyl) N-propan-2-ylcarbamate?
The canonical SMILES for (2-nitrophenyl) N-propan-2-ylcarbamate is CC(C)NC(=O)Oc1ccccc1[N+](=O)[O-].
What is the InChIKey of (2-nitrophenyl) N-propan-2-ylcarbamate?
The InChIKey is CTDRMIBQRKTHQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O4/c1-7(2)11-10(13)16-9-6-4-3-5-8(9)12(14)15/h3-7H,1-2H3,(H,11,13).
What are the key properties of (2-nitrophenyl) N-propan-2-ylcarbamate?
(2-nitrophenyl) N-propan-2-ylcarbamate has a molecular weight of 224.22 g/mol, XLogP of 2.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrophenyl) N-propan-2-ylcarbamate is sourced from PubChem (CID 11241573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).