About [2-(2-phenylethynyl)phenyl] N-propan-2-ylcarbamate
[2-(2-phenylethynyl)phenyl] N-propan-2-ylcarbamate (PubChem CID 11507410) has the molecular formula C18H17NO2
and a molecular weight of 279.34 g/mol. Its IUPAC name is [2-(2-phenylethynyl)phenyl] N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | [2-(2-phenylethynyl)phenyl] N-propan-2-ylcarbamate |
| PubChem CID | 11507410 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | [2-(2-phenylethynyl)phenyl] N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)Oc1ccccc1C#Cc1ccccc1 |
| InChI | InChI=1S/C18H17NO2/c1-14(2)19-18(20)21-17-11-7-6-10-16(17)13-12-15-8-4-3-5-9-15/h3-11,14H,1-2H3,(H,19,20) |
| InChIKey | NNCFBZHKJGKTBJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-phenylethynyl)phenyl] N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-phenylethynyl)phenyl] N-propan-2-ylcarbamate?
The IUPAC name of [2-(2-phenylethynyl)phenyl] N-propan-2-ylcarbamate (CID 11507410) is [2-(2-phenylethynyl)phenyl] N-propan-2-ylcarbamate.
What is the SMILES notation for [2-(2-phenylethynyl)phenyl] N-propan-2-ylcarbamate?
The canonical SMILES for [2-(2-phenylethynyl)phenyl] N-propan-2-ylcarbamate is CC(C)NC(=O)Oc1ccccc1C#Cc1ccccc1.
What is the InChIKey of [2-(2-phenylethynyl)phenyl] N-propan-2-ylcarbamate?
The InChIKey is NNCFBZHKJGKTBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO2/c1-14(2)19-18(20)21-17-11-7-6-10-16(17)13-12-15-8-4-3-5-9-15/h3-11,14H,1-2H3,(H,19,20).
What are the key properties of [2-(2-phenylethynyl)phenyl] N-propan-2-ylcarbamate?
[2-(2-phenylethynyl)phenyl] N-propan-2-ylcarbamate has a molecular weight of 279.34 g/mol, XLogP of 3.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-phenylethynyl)phenyl] N-propan-2-ylcarbamate is sourced from PubChem (CID 11507410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).