C19H20ClFNO2+ — CID 87622144
2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-methyl-3,4-dihydroisoquinolin-2-ium (PubChem CID 87622144) has the molecular formula C19H20ClFNO2+ and a molecular weight of 348.83 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-methyl-3,4-dihydroisoquinolin-2-ium.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-methyl-3,4-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 87622144 |
| Molecular Formula | C19H20ClFNO2+ |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methyl]-6,7-dimethoxy-1-methyl-3,4-dihydroisoquinolin-2-ium |
| SMILES | COc1cc2c(cc1OC)C(C)=[N+](Cc1c(F)cccc1Cl)CC2 |
| InChI | InChI=1S/C19H20ClFNO2/c1-12-14-10-19(24-3)18(23-2)9-13(14)7-8-22(12)11-15-16(20)5-4-6-17(15)21/h4-6,9-10H,7-8,11H2,1-3H3/q+1 |
| InChIKey | UDHJOAMMSKLZLB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|