C28H28NO4+ — CID 11421076
methyl 2-[1-(2,2-diphenylethenyl)-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium-2-yl]acetate (PubChem CID 11421076) has the molecular formula C28H28NO4+ and a molecular weight of 442.54 g/mol. Its IUPAC name is methyl 2-[1-(2,2-diphenylethenyl)-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium-2-yl]acetate.
| Compound Name | methyl 2-[1-(2,2-diphenylethenyl)-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium-2-yl]acetate |
|---|---|
| PubChem CID | 11421076 |
| Molecular Formula | C28H28NO4+ |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | methyl 2-[1-(2,2-diphenylethenyl)-6,7-dimethoxy-3,4-dihydroisoquinolin-2-ium-2-yl]acetate |
| SMILES | COC(=O)C[N+]1=C(C=C(c2ccccc2)c2ccccc2)c2cc(OC)c(OC)cc2CC1 |
| InChI | InChI=1S/C28H28NO4/c1-31-26-16-22-14-15-29(19-28(30)33-3)25(24(22)18-27(26)32-2)17-23(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-13,16-18H,14-15,19H2,1-3H3/q+1 |
| InChIKey | CUILHRNBFNAPIB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|