C20H28INOSi — CID 10479067
[(1S,2R)-1-(4-methoxyphenyl)-2-methyl-1,3-dihydroisoindol-2-ium-2-yl]methyl-trimethylsilane iodide (PubChem CID 10479067) has the molecular formula C20H28INOSi and a molecular weight of 453.44 g/mol. Its IUPAC name is [(1S,2R)-1-(4-methoxyphenyl)-2-methyl-1,3-dihydroisoindol-2-ium-2-yl]methyl-trimethylsilane iodide.
| Compound Name | [(1S,2R)-1-(4-methoxyphenyl)-2-methyl-1,3-dihydroisoindol-2-ium-2-yl]methyl-trimethylsilane iodide |
|---|---|
| PubChem CID | 10479067 |
| Molecular Formula | C20H28INOSi |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | [(1S,2R)-1-(4-methoxyphenyl)-2-methyl-1,3-dihydroisoindol-2-ium-2-yl]methyl-trimethylsilane iodide |
| SMILES | COc1ccc([C@H]2c3ccccc3C[N@@+]2(C)C[Si](C)(C)C)cc1.[I-] |
| InChI | InChI=1S/C20H28NOSi.HI/c1-21(15-23(3,4)5)14-17-8-6-7-9-19(17)20(21)16-10-12-18(22-2)13-11-16;/h6-13,20H,14-15H2,1-5H3;1H/q+1;/p-1/t20-,21-;/m0./s1 |
| InChIKey | LIVCIKAHOJTLAH-GUTACTQSSA-M |
| XLogP | 1.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|