C20H25N2O+ — CID 90474945
1-(5-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-1-methylazetidin-1-ium-3-amine (PubChem CID 90474945) has the molecular formula C20H25N2O+ and a molecular weight of 309.43 g/mol. Its IUPAC name is 1-(5-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-1-methylazetidin-1-ium-3-amine.
| Compound Name | 1-(5-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-1-methylazetidin-1-ium-3-amine |
|---|---|
| PubChem CID | 90474945 |
| Molecular Formula | C20H25N2O+ |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 1-(5-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)-1-methylazetidin-1-ium-3-amine |
| SMILES | COc1ccc2c(c1)C([N+]1(C)CC(N)C1)c1ccccc1CC2 |
| InChI | InChI=1S/C20H25N2O/c1-22(12-16(21)13-22)20-18-6-4-3-5-14(18)7-8-15-9-10-17(23-2)11-19(15)20/h3-6,9-11,16,20H,7-8,12-13,21H2,1-2H3/q+1 |
| InChIKey | LTBBZNZPWQXFCU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|