C19H26NSi+ — CID 10387574
trimethyl-[[(1R,2R)-2-methyl-1-phenyl-1,3-dihydroisoindol-2-ium-2-yl]methyl]silane (PubChem CID 10387574) has the molecular formula C19H26NSi+ and a molecular weight of 296.51 g/mol. Its IUPAC name is trimethyl-[[(1R,2R)-2-methyl-1-phenyl-1,3-dihydroisoindol-2-ium-2-yl]methyl]silane.
| Compound Name | trimethyl-[[(1R,2R)-2-methyl-1-phenyl-1,3-dihydroisoindol-2-ium-2-yl]methyl]silane |
|---|---|
| PubChem CID | 10387574 |
| Molecular Formula | C19H26NSi+ |
| Molecular Weight | 296.51 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | trimethyl-[[(1R,2R)-2-methyl-1-phenyl-1,3-dihydroisoindol-2-ium-2-yl]methyl]silane |
| SMILES | C[N@@+]1(C[Si](C)(C)C)Cc2ccccc2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H26NSi/c1-20(15-21(2,3)4)14-17-12-8-9-13-18(17)19(20)16-10-6-5-7-11-16/h5-13,19H,14-15H2,1-4H3/q+1/t19-,20+/m1/s1 |
| InChIKey | NLWSBEGLTWSQAR-UXHICEINSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|