C12H22BNSi — CID 15894052
[(1R,2S)-2-methyl-1-trimethylsilyl-1,3-dihydroisoindol-2-ium-2-yl]boranuide (PubChem CID 15894052) has the molecular formula C12H22BNSi and a molecular weight of 219.21 g/mol. Its IUPAC name is [(1R,2S)-2-methyl-1-trimethylsilyl-1,3-dihydroisoindol-2-ium-2-yl]boranuide.
| Compound Name | [(1R,2S)-2-methyl-1-trimethylsilyl-1,3-dihydroisoindol-2-ium-2-yl]boranuide |
|---|---|
| PubChem CID | 15894052 |
| Molecular Formula | C12H22BNSi |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | [(1R,2S)-2-methyl-1-trimethylsilyl-1,3-dihydroisoindol-2-ium-2-yl]boranuide |
| SMILES | [BH3-][N@+]1(C)Cc2ccccc2[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C12H22BNSi/c1-14(13)9-10-7-5-6-8-11(10)12(14)15(2,3)4/h5-8,12H,9H2,1-4,13H3/t12-,14-/m1/s1 |
| InChIKey | JDPSVMMNDMIPGA-TZMCWYRMSA-N |
| XLogP | 1.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|