C13H22INSi — CID 11725224
trimethyl-[(2-methyl-1,3-dihydroisoindol-2-ium-2-yl)methyl]silane iodide (PubChem CID 11725224) has the molecular formula C13H22INSi and a molecular weight of 347.32 g/mol. Its IUPAC name is trimethyl-[(2-methyl-1,3-dihydroisoindol-2-ium-2-yl)methyl]silane iodide.
| Compound Name | trimethyl-[(2-methyl-1,3-dihydroisoindol-2-ium-2-yl)methyl]silane iodide |
|---|---|
| PubChem CID | 11725224 |
| Molecular Formula | C13H22INSi |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | trimethyl-[(2-methyl-1,3-dihydroisoindol-2-ium-2-yl)methyl]silane iodide |
| SMILES | C[N+]1(C[Si](C)(C)C)Cc2ccccc2C1.[I-] |
| InChI | InChI=1S/C13H22NSi.HI/c1-14(11-15(2,3)4)9-12-7-5-6-8-13(12)10-14;/h5-8H,9-11H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ASXQCWVBKJHZRY-UHFFFAOYSA-M |
| XLogP | 0.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|