C17H20BrN — CID 135051106
2-methyl-2-[(2-methylphenyl)methyl]-1,3-dihydroisoindol-2-ium bromide (PubChem CID 135051106) has the molecular formula C17H20BrN and a molecular weight of 318.26 g/mol. Its IUPAC name is 2-methyl-2-[(2-methylphenyl)methyl]-1,3-dihydroisoindol-2-ium bromide.
| Compound Name | 2-methyl-2-[(2-methylphenyl)methyl]-1,3-dihydroisoindol-2-ium bromide |
|---|---|
| PubChem CID | 135051106 |
| Molecular Formula | C17H20BrN |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-methyl-2-[(2-methylphenyl)methyl]-1,3-dihydroisoindol-2-ium bromide |
| SMILES | Cc1ccccc1C[N+]1(C)Cc2ccccc2C1.[Br-] |
| InChI | InChI=1S/C17H20N.BrH/c1-14-7-3-4-8-15(14)11-18(2)12-16-9-5-6-10-17(16)13-18;/h3-10H,11-13H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | UKDCSRJQWQELHI-UHFFFAOYSA-M |
| XLogP | 0.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|