C23H30O6P2 — CID 139977734
3,9-bis[2-(2-methylphenyl)ethyl]-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane 3,9-dioxide (PubChem CID 139977734) has the molecular formula C23H30O6P2 and a molecular weight of 464.44 g/mol. Its IUPAC name is 3,9-bis[2-(2-methylphenyl)ethyl]-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane 3,9-dioxide.
| Compound Name | 3,9-bis[2-(2-methylphenyl)ethyl]-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane 3,9-dioxide |
|---|---|
| PubChem CID | 139977734 |
| Molecular Formula | C23H30O6P2 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 3,9-bis[2-(2-methylphenyl)ethyl]-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane 3,9-dioxide |
| SMILES | Cc1ccccc1CCP1(=O)OCC2(CO1)COP(=O)(CCc1ccccc1C)OC2 |
| InChI | InChI=1S/C23H30O6P2/c1-19-7-3-5-9-21(19)11-13-30(24)26-15-23(16-27-30)17-28-31(25,29-18-23)14-12-22-10-6-4-8-20(22)2/h3-10H,11-18H2,1-2H3 |
| InChIKey | SMFZXENDUKNKMN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|