About CID 57429570
CID 57429570 (PubChem CID 57429570) has the molecular formula C10H13
and a molecular weight of 133.21 g/mol.
Molecular Properties
| Compound Name | CID 57429570 |
| PubChem CID | 57429570 |
| Molecular Formula | C10H13 |
| Molecular Weight | 133.21 g/mol |
| Exact Mass | 133.10 |
| IUPAC Name | — |
| SMILES | [CH2]CCc1ccccc1C |
| InChI | InChI=1S/C10H13/c1-3-6-10-8-5-4-7-9(10)2/h4-5,7-8H,1,3,6H2,2H3 |
| InChIKey | ZBCKJAKMPGQDII-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 57429570 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57429570?
The IUPAC name of CID 57429570 (CID 57429570) is not available.
What is the SMILES notation for CID 57429570?
The canonical SMILES for CID 57429570 is [CH2]CCc1ccccc1C.
What is the InChIKey of CID 57429570?
The InChIKey is ZBCKJAKMPGQDII-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13/c1-3-6-10-8-5-4-7-9(10)2/h4-5,7-8H,1,3,6H2,2H3.
What are the key properties of CID 57429570?
CID 57429570 has a molecular weight of 133.21 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57429570 is sourced from PubChem (CID 57429570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).