About 1-ethyl-2-methylbenzene;1-hydroxy-1-methoxyaziridin-1-ium
1-ethyl-2-methylbenzene;1-hydroxy-1-methoxyaziridin-1-ium (PubChem CID 21422964) has the molecular formula C12H20NO2+
and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-ethyl-2-methylbenzene;1-hydroxy-1-methoxyaziridin-1-ium.
Molecular Properties
| Compound Name | 1-ethyl-2-methylbenzene;1-hydroxy-1-methoxyaziridin-1-ium |
| PubChem CID | 21422964 |
| Molecular Formula | C12H20NO2+ |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1-ethyl-2-methylbenzene;1-hydroxy-1-methoxyaziridin-1-ium |
| SMILES | CCc1ccccc1C.CO[N+]1(O)CC1 |
| InChI | InChI=1S/C9H12.C3H8NO2/c1-3-9-7-5-4-6-8(9)2;1-6-4(5)2-3-4/h4-7H,3H2,1-2H3;5H,2-3H2,1H3/q;+1 |
| InChIKey | LFMMXXYHFZUDAZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-methylbenzene;1-hydroxy-1-methoxyaziridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-methylbenzene;1-hydroxy-1-methoxyaziridin-1-ium?
The IUPAC name of 1-ethyl-2-methylbenzene;1-hydroxy-1-methoxyaziridin-1-ium (CID 21422964) is 1-ethyl-2-methylbenzene;1-hydroxy-1-methoxyaziridin-1-ium.
What is the SMILES notation for 1-ethyl-2-methylbenzene;1-hydroxy-1-methoxyaziridin-1-ium?
The canonical SMILES for 1-ethyl-2-methylbenzene;1-hydroxy-1-methoxyaziridin-1-ium is CCc1ccccc1C.CO[N+]1(O)CC1.
What is the InChIKey of 1-ethyl-2-methylbenzene;1-hydroxy-1-methoxyaziridin-1-ium?
The InChIKey is LFMMXXYHFZUDAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C3H8NO2/c1-3-9-7-5-4-6-8(9)2;1-6-4(5)2-3-4/h4-7H,3H2,1-2H3;5H,2-3H2,1H3/q;+1.
What are the key properties of 1-ethyl-2-methylbenzene;1-hydroxy-1-methoxyaziridin-1-ium?
1-ethyl-2-methylbenzene;1-hydroxy-1-methoxyaziridin-1-ium has a molecular weight of 210.30 g/mol, XLogP of 2.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-methylbenzene;1-hydroxy-1-methoxyaziridin-1-ium is sourced from PubChem (CID 21422964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).