C21H27F3INSi — CID 10029159
trimethyl-[[(2S,3S)-2-methyl-3-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]methyl]silane iodide (PubChem CID 10029159) has the molecular formula C21H27F3INSi and a molecular weight of 505.44 g/mol. Its IUPAC name is trimethyl-[[(2S,3S)-2-methyl-3-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]methyl]silane iodide.
| Compound Name | trimethyl-[[(2S,3S)-2-methyl-3-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]methyl]silane iodide |
|---|---|
| PubChem CID | 10029159 |
| Molecular Formula | C21H27F3INSi |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | trimethyl-[[(2S,3S)-2-methyl-3-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinolin-2-ium-2-yl]methyl]silane iodide |
| SMILES | C[N@+]1(C[Si](C)(C)C)Cc2ccccc2C[C@H]1c1ccc(C(F)(F)F)cc1.[I-] |
| InChI | InChI=1S/C21H27F3NSi.HI/c1-25(15-26(2,3)4)14-18-8-6-5-7-17(18)13-20(25)16-9-11-19(12-10-16)21(22,23)24;/h5-12,20H,13-15H2,1-4H3;1H/q+1;/p-1/t20-,25+;/m0./s1 |
| InChIKey | YGZKHRHSGGMFMZ-XWGBWKJCSA-M |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|