C13H21NSi — CID 13058280
trimethyl-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)silane (PubChem CID 13058280) has the molecular formula C13H21NSi and a molecular weight of 219.40 g/mol. Its IUPAC name is trimethyl-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)silane.
| Compound Name | trimethyl-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)silane |
|---|---|
| PubChem CID | 13058280 |
| Molecular Formula | C13H21NSi |
| Molecular Weight | 219.40 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | trimethyl-(2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)silane |
| SMILES | CN1Cc2ccccc2C([Si](C)(C)C)C1 |
| InChI | InChI=1S/C13H21NSi/c1-14-9-11-7-5-6-8-12(11)13(10-14)15(2,3)4/h5-8,13H,9-10H2,1-4H3 |
| InChIKey | OAMYBRPFMTYYFZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|