C19H25N3O — CID 88652525
N,N-diethyl-2-(2-oxido-1-pyridin-3-yl-1,3-dihydroisoindol-2-ium-2-yl)ethanamine (PubChem CID 88652525) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is N,N-diethyl-2-(2-oxido-1-pyridin-3-yl-1,3-dihydroisoindol-2-ium-2-yl)ethanamine.
| Compound Name | N,N-diethyl-2-(2-oxido-1-pyridin-3-yl-1,3-dihydroisoindol-2-ium-2-yl)ethanamine |
|---|---|
| PubChem CID | 88652525 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N,N-diethyl-2-(2-oxido-1-pyridin-3-yl-1,3-dihydroisoindol-2-ium-2-yl)ethanamine |
| SMILES | CCN(CC)CC[N+]1([O-])Cc2ccccc2C1c1cccnc1 |
| InChI | InChI=1S/C19H25N3O/c1-3-21(4-2)12-13-22(23)15-17-8-5-6-10-18(17)19(22)16-9-7-11-20-14-16/h5-11,14,19H,3-4,12-13,15H2,1-2H3 |
| InChIKey | CQLQPMYACLNGTE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|