C18H31N2O2Si+ — CID 10434473
1-[3-(4-methoxyphenyl)-4-methyl-4-(trimethylsilylmethyl)piperazin-4-ium-1-yl]ethanone (PubChem CID 10434473) has the molecular formula C18H31N2O2Si+ and a molecular weight of 335.54 g/mol. Its IUPAC name is 1-[3-(4-methoxyphenyl)-4-methyl-4-(trimethylsilylmethyl)piperazin-4-ium-1-yl]ethanone.
| Compound Name | 1-[3-(4-methoxyphenyl)-4-methyl-4-(trimethylsilylmethyl)piperazin-4-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 10434473 |
| Molecular Formula | C18H31N2O2Si+ |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 1-[3-(4-methoxyphenyl)-4-methyl-4-(trimethylsilylmethyl)piperazin-4-ium-1-yl]ethanone |
| SMILES | COc1ccc(C2CN(C(C)=O)CC[N+]2(C)C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C18H31N2O2Si/c1-15(21)19-11-12-20(2,14-23(4,5)6)18(13-19)16-7-9-17(22-3)10-8-16/h7-10,18H,11-14H2,1-6H3/q+1 |
| InChIKey | MMCRMEWFSQXBJK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|