C20H29NO4 — CID 161142498
tert-butyl 2-[(3S)-1-acetyl-4-(4-methoxyphenyl)piperidin-3-yl]acetate (PubChem CID 161142498) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is tert-butyl 2-[(3S)-1-acetyl-4-(4-methoxyphenyl)piperidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3S)-1-acetyl-4-(4-methoxyphenyl)piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 161142498 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | tert-butyl 2-[(3S)-1-acetyl-4-(4-methoxyphenyl)piperidin-3-yl]acetate |
| SMILES | COc1ccc(C2CCN(C(C)=O)C[C@H]2CC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H29NO4/c1-14(22)21-11-10-18(15-6-8-17(24-5)9-7-15)16(13-21)12-19(23)25-20(2,3)4/h6-9,16,18H,10-13H2,1-5H3/t16-,18?/m1/s1 |
| InChIKey | BALHZHIEZIYZAI-PYUWXLGESA-N |
| XLogP | 3.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |