C18H27NO6S — CID 153407398
tert-butyl (3S,4R)-3-(4-methoxyphenyl)-4-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate (PubChem CID 153407398) has the molecular formula C18H27NO6S and a molecular weight of 385.48 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-(4-methoxyphenyl)-4-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-3-(4-methoxyphenyl)-4-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 153407398 |
| Molecular Formula | C18H27NO6S |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | tert-butyl (3S,4R)-3-(4-methoxyphenyl)-4-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate |
| SMILES | COc1ccc([C@H]2CN(C(=O)OC(C)(C)C)C[C@@H]2COS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H27NO6S/c1-18(2,3)25-17(20)19-10-14(12-24-26(5,21)22)16(11-19)13-6-8-15(23-4)9-7-13/h6-9,14,16H,10-12H2,1-5H3/t14-,16-/m1/s1 |
| InChIKey | KAARZIVHZCBKMC-GDBMZVCRSA-N |
| XLogP | 2.62 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|