C19H27NO4 — CID 175460460
tert-butyl 4-formyl-5-(4-methoxyphenyl)azepane-1-carboxylate (PubChem CID 175460460) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is tert-butyl 4-formyl-5-(4-methoxyphenyl)azepane-1-carboxylate.
| Compound Name | tert-butyl 4-formyl-5-(4-methoxyphenyl)azepane-1-carboxylate |
|---|---|
| PubChem CID | 175460460 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | tert-butyl 4-formyl-5-(4-methoxyphenyl)azepane-1-carboxylate |
| SMILES | COc1ccc(C2CCN(C(=O)OC(C)(C)C)CCC2C=O)cc1 |
| InChI | InChI=1S/C19H27NO4/c1-19(2,3)24-18(22)20-11-9-15(13-21)17(10-12-20)14-5-7-16(23-4)8-6-14/h5-8,13,15,17H,9-12H2,1-4H3 |
| InChIKey | RQNWHJSPYURPFA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|