C17H22FNO3 — CID 86604441
tert-butyl 4-(4-fluorophenyl)-3-formylpiperidine-1-carboxylate (PubChem CID 86604441) has the molecular formula C17H22FNO3 and a molecular weight of 307.37 g/mol. Its IUPAC name is tert-butyl 4-(4-fluorophenyl)-3-formylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-fluorophenyl)-3-formylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 86604441 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | tert-butyl 4-(4-fluorophenyl)-3-formylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(F)cc2)C(C=O)C1 |
| InChI | InChI=1S/C17H22FNO3/c1-17(2,3)22-16(21)19-9-8-15(13(10-19)11-20)12-4-6-14(18)7-5-12/h4-7,11,13,15H,8-10H2,1-3H3 |
| InChIKey | LCDXBBXAXHKLCM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|