C18H28FNO3 — CID 144885917
tert-butyl (4S)-3-fluoro-4-(4-hydroxyphenyl)piperidine-1-carboxylate;ethane (PubChem CID 144885917) has the molecular formula C18H28FNO3 and a molecular weight of 325.42 g/mol. Its IUPAC name is tert-butyl (4S)-3-fluoro-4-(4-hydroxyphenyl)piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl (4S)-3-fluoro-4-(4-hydroxyphenyl)piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 144885917 |
| Molecular Formula | C18H28FNO3 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | tert-butyl (4S)-3-fluoro-4-(4-hydroxyphenyl)piperidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CC[C@@H](c2ccc(O)cc2)C(F)C1 |
| InChI | InChI=1S/C16H22FNO3.C2H6/c1-16(2,3)21-15(20)18-9-8-13(14(17)10-18)11-4-6-12(19)7-5-11;1-2/h4-7,13-14,19H,8-10H2,1-3H3;1-2H3/t13-,14?;/m0./s1 |
| InChIKey | IPGIREIXTPCKRX-GPFYXIAXSA-N |
| XLogP | 4.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |