C20H30FNO3 — CID 118221140
tert-butyl (3S,4R)-4-(4-butoxyphenyl)-3-fluoropiperidine-1-carboxylate (PubChem CID 118221140) has the molecular formula C20H30FNO3 and a molecular weight of 351.46 g/mol. Its IUPAC name is tert-butyl (3S,4R)-4-(4-butoxyphenyl)-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4R)-4-(4-butoxyphenyl)-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 118221140 |
| Molecular Formula | C20H30FNO3 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | tert-butyl (3S,4R)-4-(4-butoxyphenyl)-3-fluoropiperidine-1-carboxylate |
| SMILES | CCCCOc1ccc([C@H]2CCN(C(=O)OC(C)(C)C)C[C@H]2F)cc1 |
| InChI | InChI=1S/C20H30FNO3/c1-5-6-13-24-16-9-7-15(8-10-16)17-11-12-22(14-18(17)21)19(23)25-20(2,3)4/h7-10,17-18H,5-6,11-14H2,1-4H3/t17-,18-/m1/s1 |
| InChIKey | PPNOCESQIHUHJI-QZTJIDSGSA-N |
| XLogP | 4.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|