C20H25FN2O4 — CID 140756657
tert-butyl 3-fluoro-4-[4-(2-isocyanoacetyl)-3-methoxyphenyl]piperidine-1-carboxylate (PubChem CID 140756657) has the molecular formula C20H25FN2O4 and a molecular weight of 376.43 g/mol. Its IUPAC name is tert-butyl 3-fluoro-4-[4-(2-isocyanoacetyl)-3-methoxyphenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-fluoro-4-[4-(2-isocyanoacetyl)-3-methoxyphenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140756657 |
| Molecular Formula | C20H25FN2O4 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | tert-butyl 3-fluoro-4-[4-(2-isocyanoacetyl)-3-methoxyphenyl]piperidine-1-carboxylate |
| SMILES | [C-]#[N+]CC(=O)c1ccc(C2CCN(C(=O)OC(C)(C)C)CC2F)cc1OC |
| InChI | InChI=1S/C20H25FN2O4/c1-20(2,3)27-19(25)23-9-8-14(16(21)12-23)13-6-7-15(17(24)11-22-4)18(10-13)26-5/h6-7,10,14,16H,8-9,11-12H2,1-3,5H3 |
| InChIKey | TYQITQSNOYRKIM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|