C24H27FN2O4 — CID 154587108
tert-butyl 3-fluoro-4-[3-isocyano-5-(2-methoxyphenyl)phenoxy]piperidine-1-carboxylate (PubChem CID 154587108) has the molecular formula C24H27FN2O4 and a molecular weight of 426.49 g/mol. Its IUPAC name is tert-butyl 3-fluoro-4-[3-isocyano-5-(2-methoxyphenyl)phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-fluoro-4-[3-isocyano-5-(2-methoxyphenyl)phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 154587108 |
| Molecular Formula | C24H27FN2O4 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | tert-butyl 3-fluoro-4-[3-isocyano-5-(2-methoxyphenyl)phenoxy]piperidine-1-carboxylate |
| SMILES | [C-]#[N+]c1cc(OC2CCN(C(=O)OC(C)(C)C)CC2F)cc(-c2ccccc2OC)c1 |
| InChI | InChI=1S/C24H27FN2O4/c1-24(2,3)31-23(28)27-11-10-22(20(25)15-27)30-18-13-16(12-17(14-18)26-4)19-8-6-7-9-21(19)29-5/h6-9,12-14,20,22H,10-11,15H2,1-3,5H3 |
| InChIKey | OPLVZWLCESDIAL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 52.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|