C22H21FN2O3 — CID 147621051
3-[(3S,4S)-3-fluoro-1-prop-2-enoylpiperidin-4-yl]oxy-5-(2-methoxyphenyl)benzonitrile (PubChem CID 147621051) has the molecular formula C22H21FN2O3 and a molecular weight of 380.42 g/mol. Its IUPAC name is 3-[(3S,4S)-3-fluoro-1-prop-2-enoylpiperidin-4-yl]oxy-5-(2-methoxyphenyl)benzonitrile.
| Compound Name | 3-[(3S,4S)-3-fluoro-1-prop-2-enoylpiperidin-4-yl]oxy-5-(2-methoxyphenyl)benzonitrile |
|---|---|
| PubChem CID | 147621051 |
| Molecular Formula | C22H21FN2O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-[(3S,4S)-3-fluoro-1-prop-2-enoylpiperidin-4-yl]oxy-5-(2-methoxyphenyl)benzonitrile |
| SMILES | C=CC(=O)N1CC[C@H](Oc2cc(C#N)cc(-c3ccccc3OC)c2)[C@@H](F)C1 |
| InChI | InChI=1S/C22H21FN2O3/c1-3-22(26)25-9-8-21(19(23)14-25)28-17-11-15(13-24)10-16(12-17)18-6-4-5-7-20(18)27-2/h3-7,10-12,19,21H,1,8-9,14H2,2H3/t19-,21-/m0/s1 |
| InChIKey | GDWIGHRWBZINGZ-FPOVZHCZSA-N |
| XLogP | 3.74 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|