C42H42ClN5O5 — CID 153207331
3-[4-[5-chloro-2-[1-[(E)-2-cyanobut-2-enoyl]piperidin-4-yl]oxyphenyl]-2-methoxyphenyl]-5-[1-[(E)-2-cyano-4-methylpent-2-enoyl]piperidin-4-yl]oxybenzonitrile (PubChem CID 153207331) has the molecular formula C42H42ClN5O5 and a molecular weight of 732.28 g/mol. Its IUPAC name is 3-[4-[5-chloro-2-[1-[(E)-2-cyanobut-2-enoyl]piperidin-4-yl]oxyphenyl]-2-methoxyphenyl]-5-[1-[(E)-2-cyano-4-methylpent-2-enoyl]piperidin-4-yl]oxybenzonitrile.
| Compound Name | 3-[4-[5-chloro-2-[1-[(E)-2-cyanobut-2-enoyl]piperidin-4-yl]oxyphenyl]-2-methoxyphenyl]-5-[1-[(E)-2-cyano-4-methylpent-2-enoyl]piperidin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 153207331 |
| Molecular Formula | C42H42ClN5O5 |
| Molecular Weight | 732.28 g/mol |
| Exact Mass | 731.29 |
| IUPAC Name | 3-[4-[5-chloro-2-[1-[(E)-2-cyanobut-2-enoyl]piperidin-4-yl]oxyphenyl]-2-methoxyphenyl]-5-[1-[(E)-2-cyano-4-methylpent-2-enoyl]piperidin-4-yl]oxybenzonitrile |
| SMILES | C/C=C(\C#N)C(=O)N1CCC(Oc2ccc(Cl)cc2-c2ccc(-c3cc(C#N)cc(OC4CCN(C(=O)/C(C#N)=C/C(C)C)CC4)c3)c(OC)c2)CC1 |
| InChI | InChI=1S/C42H42ClN5O5/c1-5-29(25-45)41(49)47-16-12-35(13-17-47)53-39-9-7-33(43)23-38(39)30-6-8-37(40(22-30)51-4)31-19-28(24-44)20-36(21-31)52-34-10-14-48(15-11-34)42(50)32(26-46)18-27(2)3/h5-9,18-23,27,34-35H,10-17H2,1-4H3/b29-5+,32-18+ |
| InChIKey | WLBXZQIFODBPFP-YZUJQMJMSA-N |
| XLogP | 7.87 |
| TPSA | 139.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.28 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|