C22H21FN2O3 — CID 154587243
1-[(3R,4R)-3-fluoro-4-[3-isocyano-5-(2-methoxyphenyl)phenoxy]piperidin-1-yl]prop-2-en-1-one (PubChem CID 154587243) has the molecular formula C22H21FN2O3 and a molecular weight of 380.42 g/mol. Its IUPAC name is 1-[(3R,4R)-3-fluoro-4-[3-isocyano-5-(2-methoxyphenyl)phenoxy]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R,4R)-3-fluoro-4-[3-isocyano-5-(2-methoxyphenyl)phenoxy]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 154587243 |
| Molecular Formula | C22H21FN2O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 1-[(3R,4R)-3-fluoro-4-[3-isocyano-5-(2-methoxyphenyl)phenoxy]piperidin-1-yl]prop-2-en-1-one |
| SMILES | [C-]#[N+]c1cc(O[C@@H]2CCN(C(=O)C=C)C[C@H]2F)cc(-c2ccccc2OC)c1 |
| InChI | InChI=1S/C22H21FN2O3/c1-4-22(26)25-10-9-21(19(23)14-25)28-17-12-15(11-16(13-17)24-2)18-7-5-6-8-20(18)27-3/h4-8,11-13,19,21H,1,9-10,14H2,3H3/t19-,21-/m1/s1 |
| InChIKey | MUMSNTRMEUCVTI-TZIWHRDSSA-N |
| XLogP | 4.42 |
| TPSA | 43.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|