C23H25NO3 — CID 154587105
1-[7-(2-methoxyphenyl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl]prop-2-en-1-one (PubChem CID 154587105) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-[7-(2-methoxyphenyl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl]prop-2-en-1-one.
| Compound Name | 1-[7-(2-methoxyphenyl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 154587105 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-[7-(2-methoxyphenyl)spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC2(CCc3ccc(-c4ccccc4OC)cc3O2)CC1 |
| InChI | InChI=1S/C23H25NO3/c1-3-22(25)24-14-12-23(13-15-24)11-10-17-8-9-18(16-21(17)27-23)19-6-4-5-7-20(19)26-2/h3-9,16H,1,10-15H2,2H3 |
| InChIKey | BVVNAHLTXDWSLX-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|