C16H22ClFN2O3 — CID 86704517
tert-butyl (3S,4S)-4-(4-amino-2-chlorophenoxy)-3-fluoropiperidine-1-carboxylate (PubChem CID 86704517) has the molecular formula C16H22ClFN2O3 and a molecular weight of 344.81 g/mol. Its IUPAC name is tert-butyl (3S,4S)-4-(4-amino-2-chlorophenoxy)-3-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-4-(4-amino-2-chlorophenoxy)-3-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 86704517 |
| Molecular Formula | C16H22ClFN2O3 |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | tert-butyl (3S,4S)-4-(4-amino-2-chlorophenoxy)-3-fluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](Oc2ccc(N)cc2Cl)[C@@H](F)C1 |
| InChI | InChI=1S/C16H22ClFN2O3/c1-16(2,3)23-15(21)20-7-6-14(12(18)9-20)22-13-5-4-10(19)8-11(13)17/h4-5,8,12,14H,6-7,9,19H2,1-3H3/t12-,14-/m0/s1 |
| InChIKey | WMKXTOMELDVJAK-JSGCOSHPSA-N |
| XLogP | 3.65 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|