C18H23ClFNO3 — CID 170774019
tert-butyl (3aS,6aR)-5-(2-chloro-4-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 170774019) has the molecular formula C18H23ClFNO3 and a molecular weight of 355.84 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-5-(2-chloro-4-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-5-(2-chloro-4-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 170774019 |
| Molecular Formula | C18H23ClFNO3 |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | tert-butyl (3aS,6aR)-5-(2-chloro-4-fluorophenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC(Oc3ccc(F)cc3Cl)C[C@H]2C1 |
| InChI | InChI=1S/C18H23ClFNO3/c1-18(2,3)24-17(22)21-9-11-6-14(7-12(11)10-21)23-16-5-4-13(20)8-15(16)19/h4-5,8,11-12,14H,6-7,9-10H2,1-3H3/t11-,12+,14? |
| InChIKey | KFTSQVBBJUVSLC-ONXXMXGDSA-N |
| XLogP | 4.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |