C16H18ClFN2O2 — CID 142381652
tert-butyl 3-(3-chloro-5-fluoroindol-1-yl)azetidine-1-carboxylate (PubChem CID 142381652) has the molecular formula C16H18ClFN2O2 and a molecular weight of 324.78 g/mol. Its IUPAC name is tert-butyl 3-(3-chloro-5-fluoroindol-1-yl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-chloro-5-fluoroindol-1-yl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 142381652 |
| Molecular Formula | C16H18ClFN2O2 |
| Molecular Weight | 324.78 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | tert-butyl 3-(3-chloro-5-fluoroindol-1-yl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(n2cc(Cl)c3cc(F)ccc32)C1 |
| InChI | InChI=1S/C16H18ClFN2O2/c1-16(2,3)22-15(21)19-7-11(8-19)20-9-13(17)12-6-10(18)4-5-14(12)20/h4-6,9,11H,7-8H2,1-3H3 |
| InChIKey | AULQYQSVGSJINF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.78 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |